For research use only. Not for therapeutic Use.
1-(3-Hydroxypropyl)pyrrolidin-2-one(Cat No.:L021080)is a heterocyclic compound used in organic synthesis and pharmaceutical research. The molecule features a pyrrolidin-2-one ring with a hydroxypropyl group attached to the nitrogen atom, providing unique reactivity and versatility. This compound is valuable as an intermediate in the synthesis of complex molecules, including potential drug candidates and fine chemicals. The hydroxyl group allows for further functionalization, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced synthetic materials. Its structure also offers potential for modifying biological activity in therapeutic agents.
CAS Number | 62012-15-1 |
Molecular Formula | C7H13NO2 |
Purity | ≥95% |
IUPAC Name | 1-(3-hydroxypropyl)pyrrolidin-2-one |
InChI | InChI=1S/C7H13NO2/c9-6-2-5-8-4-1-3-7(8)10/h9H,1-6H2 |
InChIKey | CVDGNRZPDAXOQO-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1)CCCO |