For research use only. Not for therapeutic Use.
1-(3-Methanesulfonylphenyl)ethan-1-ol(Cat No.:L007806), is a chemical compound characterized by a hydroxyethyl group (C2H5O) attached to a phenyl ring substituted with a methanesulfonyl (CH3SO2) moiety. This structure implies the presence of a hydroxyl group (-OH) connected to the ethyl group, while the phenyl ring is modified with a methanesulfonyl group. Methanesulfonyl derivatives are significant in organic synthesis, often used as protecting groups or functional moieties in various reactions. This compound’s specific structure suggests potential applications in medicinal chemistry, where specific functional groups are crucial for the development of novel drugs or pharmaceutical intermediates.
CAS Number | 911715-97-4 |
Molecular Formula | C9H12O3S |
Purity | ≥95% |
IUPAC Name | 1-(3-methylsulfonylphenyl)ethanol |
InChI | InChI=1S/C9H12O3S/c1-7(10)8-4-3-5-9(6-8)13(2,11)12/h3-7,10H,1-2H3 |
InChIKey | AIQAQFDMERPUAH-UHFFFAOYSA-N |
SMILES | CC(C1=CC(=CC=C1)S(=O)(=O)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |