For research use only. Not for therapeutic Use.
1-(3-Methoxyphenyl)-2-methylpropan-1-one (Cat.No:L003462) is a crucial compound in organic synthesis. Also known as veratraldehyde, it finds application in fragrance and flavor industries. With its distinctive aromatic profile, it imparts a sweet, vanilla-like scent. Additionally, it serves as a valuable intermediate in pharmaceutical and agrochemical manufacturing. This compound’s versatility and role in multiple industries underscore its significance in contemporary chemical research and production processes.
Catalog Number | L003462 |
CAS Number | 6026-75-1 |
Molecular Formula | C11H14O2 |
Purity | ≥95% |
IUPAC Name | 1-(3-methoxyphenyl)-2-methylpropan-1-one |
InChI | InChI=1S/C11H14O2/c1-8(2)11(12)9-5-4-6-10(7-9)13-3/h4-8H,1-3H3 |
InChIKey | NINIAUCIBWCJSG-UHFFFAOYSA-N |
SMILES | CC(C)C(=O)C1=CC(=CC=C1)OC |