For research use only. Not for therapeutic Use.
1-(3-Methoxyphenyl)-3-methylbutan-1-one is an aromatic ketone characterized by a 3-methoxyphenyl group and a 3-methylbutan-1-one structure. This compound exhibits distinctive chemical properties due to the presence of both the aromatic and aliphatic components, making it useful in organic synthesis. Its ketone functionality enables various reactions, such as nucleophilic additions and reductions. This compound may serve as a valuable intermediate in the development of pharmaceuticals and other organic compounds, facilitating exploration of structure-activity relationships in medicinal chemistry.
CAS Number | 1183770-52-6 |
Molecular Formula | C12H16O2 |
Purity | ≥95% |
IUPAC Name | 1-(3-methoxyphenyl)-3-methylbutan-1-one |
InChI | InChI=1S/C12H16O2/c1-9(2)7-12(13)10-5-4-6-11(8-10)14-3/h4-6,8-9H,7H2,1-3H3 |
InChIKey | RIEWMJBAOYZLCB-UHFFFAOYSA-N |
SMILES | CC(C)CC(=O)C1=CC(=CC=C1)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |