For research use only. Not for therapeutic Use.
1-(3-Methoxypyridin-2-yl)hydrazine(Cat No.:L006303)is a heterocyclic compound featuring a methoxy group at the 3-position of a pyridine ring and a hydrazine moiety attached at the 2-position. This compound is valuable in pharmaceutical research and organic synthesis as an intermediate for developing bioactive molecules, including potential drug candidates. The hydrazine group provides reactivity for forming hydrazones and other derivatives, while the methoxy-substituted pyridine enhances the compound’s versatility in chemical reactions. Its high purity and reactivity make it essential for advanced research in medicinal chemistry and synthetic applications.
CAS Number | 210992-34-0 |
Molecular Formula | C6H9N3O |
Purity | ≥95% |
IUPAC Name | (3-methoxypyridin-2-yl)hydrazine |
InChI | InChI=1S/C6H9N3O/c1-10-5-3-2-4-8-6(5)9-7/h2-4H,7H2,1H3,(H,8,9) |
InChIKey | PCGPJDDXEJWUMZ-UHFFFAOYSA-N |
SMILES | COC1=C(N=CC=C1)NN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |