For research use only. Not for therapeutic Use.
1-(3-Methoxypyridin-4-yl)ethanone(Cat No.:L039538)is a versatile chemical compound commonly used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and fine chemicals. This pyridine derivative features a methoxy group at the 3-position and an ethanone group at the 4-position, providing a unique structure that facilitates various chemical reactions. Its reactivity and functional groups make it a valuable building block for the synthesis of complex molecules, playing a crucial role in medicinal chemistry and the creation of novel therapeutic agents.
CAS Number | 83431-02-1 |
Molecular Formula | C8H9NO2 |
Purity | ≥95% |
IUPAC Name | 1-(3-methoxypyridin-4-yl)ethanone |
InChI | InChI=1S/C8H9NO2/c1-6(10)7-3-4-9-5-8(7)11-2/h3-5H,1-2H3 |
InChIKey | GQTWZLYQSMCSSU-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=NC=C1)OC |