For research use only. Not for therapeutic Use.
1-(3-Pyridyl)-1,4-butanediol(Cat No.:R001062), also known as PBD, is a chemical compound with a molecular formula C9H13NO2. It is a colorless liquid that is used in the synthesis of pharmaceuticals and agrochemicals. PBD is a versatile building block in organic synthesis, often employed in the preparation of heterocyclic compounds. Its structure includes a pyridine ring and a butanediol moiety, making it valuable for creating diverse chemical structures. PBD has applications in medicinal chemistry, serving as a precursor for the synthesis of drugs targeting various biological pathways.
CAS Number | 76014-83-0 |
Synonyms | 4-Hydroxy-4-(3-pyridyl)-butan-1-ol; 4-Hydroxy-4-(3-pyridyl)-butanol; |
Molecular Formula | C9H13NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-pyridin-3-ylbutane-1,4-diol |
InChI | InChI=1S/C9H13NO2/c11-6-2-4-9(12)8-3-1-5-10-7-8/h1,3,5,7,9,11-12H,2,4,6H2 |
InChIKey | RGJHRVMTLGLFPX-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C(CCCO)O |