For research use only. Not for therapeutic Use.
{1-[3-(Trifluoromethyl)phenyl]cyclopentyl}(Cat No.:L025003)is a specialized organic compound used in pharmaceutical and chemical research. It features a cyclopentyl ring attached to a 3-(trifluoromethyl)phenyl group, making it a versatile intermediate in synthesizing various bioactive molecules. This compound is particularly valuable in developing potential therapeutic agents, especially in areas like oncology and central nervous system disorders. The trifluoromethyl group enhances the compound’s metabolic stability and lipophilicity, making {1-[3-(Trifluoromethyl)phenyl]cyclopentyl} an important building block for medicinal chemists working on innovative drug discovery projects.
CAS Number | 1152568-45-0 |
Molecular Formula | C13H16F3N |
Purity | ≥95% |
IUPAC Name | [1-[3-(trifluoromethyl)phenyl]cyclopentyl]methanamine |
InChI | InChI=1S/C13H16F3N/c14-13(15,16)11-5-3-4-10(8-11)12(9-17)6-1-2-7-12/h3-5,8H,1-2,6-7,9,17H2 |
InChIKey | VZMRAPSRBGTZOB-UHFFFAOYSA-N |
SMILES | C1CCC(C1)(CN)C2=CC(=CC=C2)C(F)(F)F |