For research use only, not for therapeutic use.
1-(3,4-Dichlorobenzyl)-1H-pyrazol-3-amine is a pyrazole derivative featuring a dichlorobenzyl group at the first position and an amine group at the third position of the pyrazole ring. This compound exhibits significant biological activity and has garnered interest in medicinal chemistry for its potential applications in drug development. The presence of the dichlorobenzyl moiety may enhance its pharmacological properties. Additionally, its structure allows for further modifications, paving the way for the design of novel therapeutic agents with improved efficacy and selectivity.
Catalog Number | L020009 |
CAS Number | 895929-56-3 |
Molecular Formula | C10H9Cl2N3 |
Purity | ≥95% |
IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]pyrazol-3-amine |
InChI | InChI=1S/C10H9Cl2N3/c11-8-2-1-7(5-9(8)12)6-15-4-3-10(13)14-15/h1-5H,6H2,(H2,13,14) |
InChIKey | HDCJOTJJYUOQLE-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1CN2C=CC(=N2)N)Cl)Cl |