For research use only. Not for therapeutic Use.
1-(3,4-dichlorophenyl)-1H-pyrazole-3-carboxylic acid(Cat No.:L007497), is a chemical compound of interest in medicinal chemistry. Its molecular structure features a pyrazole ring with a carboxylic acid group and dichlorophenyl substituents. This compound is crucial in pharmaceutical research, often serving as a key scaffold in the development of potential therapeutic agents. Scientists explore its reactivity and biological activities to design novel drugs. The compound’s specific interactions with biological targets are studied intensively, aiming to harness its pharmacological potential.
CAS Number | 1152949-12-6 |
Molecular Formula | C10H6Cl2N2O2 |
Purity | ≥95% |
IUPAC Name | 1-(3,4-dichlorophenyl)pyrazole-3-carboxylic acid |
InChI | InChI=1S/C10H6Cl2N2O2/c11-7-2-1-6(5-8(7)12)14-4-3-9(13-14)10(15)16/h1-5H,(H,15,16) |
InChIKey | QSPGYAIOLVRCEY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1N2C=CC(=N2)C(=O)O)Cl)Cl |