Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propan-1-one
For research use only. Not for therapeutic Use.
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propan-1-one(CAT: L000397) is a chemical compound with potential applications in both pharmaceutical and organic chemistry. This compound can serve as an intermediate for the synthesis of various organic molecules, particularly those with potential pharmaceutical applications. In pharmaceutical chemistry, it plays a pivotal role in the creation of novel drug candidates, as it contains a unique 1,5-benzodioxepin core. Its significance lies in its role in drug discovery and the development of potential therapeutic agents.
Catalog Number | L000397 |
CAS Number | 111038-94-9 |
Molecular Formula | C12H14O3 |
Purity | ≥95% |
IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propan-1-one |
InChI | InChI=1S/C12H14O3/c1-2-10(13)9-4-5-11-12(8-9)15-7-3-6-14-11/h4-5,8H,2-3,6-7H2,1H3 |
InChIKey | WTSBSCIGLWOZGU-UHFFFAOYSA-N |