Home
>
Reference Standards>Heterocyclic Building Blocks> 1-(3,4-DIMETHYLPHENYL)-3-METHYL-3-PYRAZOLIN-5-ONE
For research use only. Not for therapeutic Use.
1-(3,4-Dimethylphenyl)-3-methyl-3-pyrazolin-5-one(Cat No.:M082108)is a specialized organic compound commonly used in pharmaceutical and chemical research. Featuring a dimethylphenyl group attached to a pyrazolinone ring, this compound serves as an important intermediate in the synthesis of various bioactive molecules and therapeutic agents. Its unique structure allows for diverse chemical modifications, making it valuable in the development of new drugs and fine chemicals. 1-(3,4-Dimethylphenyl)-3-methyl-3-pyrazolin-5-one plays a crucial role in high-precision synthesis, supporting advancements in medicinal chemistry and innovative research.
CAS Number | 18048-64-1 |
Molecular Formula | C12H14N2O |
Purity | ≥95% |
IUPAC Name | 2-(3,4-dimethylphenyl)-5-methyl-4H-pyrazol-3-one |
InChI | InChI=1S/C12H14N2O/c1-8-4-5-11(6-9(8)2)14-12(15)7-10(3)13-14/h4-6H,7H2,1-3H3 |
InChIKey | GJBBAPXESBCGRU-UHFFFAOYSA-N |
SMILES | CC1=NN(C(=O)C1)C2=CC(=C(C=C2)C)C |