For research use only. Not for therapeutic Use.
1-(3,5-Bis(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone (Cat.No:L003635) is a significant chemical compound in synthetic chemistry. Its unique trifluoromethylated structure imparts valuable reactivity, making it a key intermediate in the synthesis of specialized compounds. This ketone is employed in the preparation of diverse materials, pharmaceuticals, and agrochemicals, showcasing its importance in modern chemical research. I
CAS Number | 130336-17-3 |
Molecular Formula | C10H3F9O |
Purity | ≥95% |
IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone |
InChI | InChI=1S/C10H3F9O/c11-8(12,13)5-1-4(7(20)10(17,18)19)2-6(3-5)9(14,15)16/h1-3H |
InChIKey | AMSJGWJKJSLIEU-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)C(F)(F)F |