For research use only. Not for therapeutic Use.
1-(3,5-Dibromophenyl)piperidine(CAT: M142757)is a chemical compound with a piperidine ring substituted by a dibromophenyl group. Its mode of action and pharmacological effects are not extensively documented, suggesting it may primarily serve as a chemical intermediate or a building block in various synthetic processes. Compounds like 1-(3,5-Dibromophenyl)piperidine often play roles in organic synthesis for creating more complex molecules for pharmaceuticals, agrochemicals, or other specialized applications.
CAS Number | 1261995-07-6 |
Synonyms | 1-(3,5-Dibromophenyl)piperidine |
Molecular Formula | C11H13Br2N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(3,5-dibromophenyl)piperidine |
InChI | InChI=1S/C11H13Br2N/c12-9-6-10(13)8-11(7-9)14-4-2-1-3-5-14/h6-8H,1-5H2 |
InChIKey | XJRXMTGCKLGGJU-UHFFFAOYSA-N |
SMILES | C1CCN(CC1)C2=CC(=CC(=C2)Br)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |