Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-(3,5-Dichloropyridin-4-yl)piperidine-4-carboxamide
For research use only. Not for therapeutic Use.
1-(3,5-Dichloropyridin-4-yl)piperidine-4-carboxamide (Cat No.:L024654) is an organic compound featuring a piperidine ring with a pyridine ring attached, bearing dichlorine substituents at positions 3 and 5. The name indicates a carboxamide group attached to the piperidine ring at position 4. This unique structure makes it potentially valuable in pharmaceutical research, where it may serve as a building block for bioactive molecules or as a lead compound in drug development. Its diverse chemical properties offer opportunities for modifications and exploration in medicinal chemistry and drug discovery.
CAS Number | 685115-77-9 |
Molecular Formula | C11H13Cl2N3O |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1-(3,5-dichloropyridin-4-yl)piperidine-4-carboxamide |
InChI | InChI=1S/C11H13Cl2N3O/c12-8-5-15-6-9(13)10(8)16-3-1-7(2-4-16)11(14)17/h5-7H,1-4H2,(H2,14,17) |
InChIKey | BJCHGDBASIDUOJ-UHFFFAOYSA-N |
SMILES | C1CN(CCC1C(=O)N)C2=C(C=NC=C2Cl)Cl |