For research use only. Not for therapeutic Use.
1-(3,5-Difluorophenyl)propan-2-one(CAT: L000217) is a significant compound in organic chemistry, especially in the synthesis of various organic molecules. This compound serves as a valuable intermediate for creating a wide range of organic intermediates, including pharmaceutical agents and agrochemicals. Its chemical structure, featuring a ketone group and difluorophenyl substitution, allows for precise structural modifications, making it a key component for researchers in the design and synthesis of complex molecules.
CAS Number | 865774-77-2 |
Molecular Formula | C9H8F2O |
Purity | ≥95% |
IUPAC Name | 1-(3,5-difluorophenyl)propan-2-one |
InChI | InChI=1S/C9H8F2O/c1-6(12)2-7-3-8(10)5-9(11)4-7/h3-5H,2H2,1H3 |
InChIKey | GANUXJOOWCWFLI-UHFFFAOYSA-N |