Home
>
Reference Standards>Other Inhibitors> 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydropyridin-1(2h)-yl)ethanone
For research use only. Not for therapeutic Use.
1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydropyridin-1(2H)-yl)ethanone(CAT: M072814) is a chemical compound characterized by a complex structure containing a dioxaborolane ring, a dihydropyridine ring, and an ethanone functional group. Its mode of action and pharmacological effects are not explicitly documented, suggesting it may be used as a chemical intermediate or building block in various synthetic processes. Compounds like 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydropyridin-1(2H)-yl)ethanone often play roles in organic synthesis for the creation of more complex molecules, potentially in pharmaceutical or materials science applications.
CAS Number | 1227068-67-8 |
Molecular Formula | C13H22BNO3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
InChI | InChI=1S/C13H22BNO3/c1-10(16)15-8-6-11(7-9-15)14-17-12(2,3)13(4,5)18-14/h6H,7-9H2,1-5H3 |
InChIKey | RENBVEOCTVQABH-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCN(CC2)C(=O)C |