For research use only. Not for therapeutic Use.
1-(4-(9H-carbazol-9-yl)phenyl)ethanone (Cat.No:L003465) is a significant chemical compound with versatile applications. Its distinctive structure, combining a carbazole unit with a phenyl ketone moiety, renders it valuable in materials science and pharmaceuticals. This compound serves as a crucial intermediate in the synthesis of specialized materials and potentially bioactive compounds.
CAS Number | 142116-85-6 |
Molecular Formula | C20H15NO |
Purity | ≥95% |
IUPAC Name | 1-(4-carbazol-9-ylphenyl)ethanone |
InChI | InChI=1S/C20H15NO/c1-14(22)15-10-12-16(13-11-15)21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21/h2-13H,1H3 |
InChIKey | MROKJEYKOKZQEK-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC=C(C=C1)N2C3=CC=CC=C3C4=CC=CC=C42 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |