For research use only. Not for therapeutic Use.
1-(4-Amino-3-bromo-phenyl)-ethanone(CAT: L021053) is a high-purity compound essential for advanced chemical and pharmaceutical research. Featuring an amino and bromo-substituted phenyl structure, this compound serves as a versatile intermediate in the synthesis of complex organic molecules, including potential drug candidates. Its well-defined chemical properties make it ideal for structure-activity relationship studies and targeted molecule design. With superior stability and purity, 1-(4-Amino-3-bromo-phenyl)-ethanone ensures consistent results in diverse experimental setups. Widely used in medicinal chemistry and material sciences, this compound supports innovative research endeavors and accelerates the development of novel therapeutic agents.
CAS Number | 56759-32-1 |
Molecular Formula | C8H8BrNO |
Purity | ≥95% |
IUPAC Name | 1-(4-amino-3-bromophenyl)ethanone |
InChI | InChI=1S/C8H8BrNO/c1-5(11)6-2-3-8(10)7(9)4-6/h2-4H,10H2,1H3 |
InChIKey | ASMVJBACZFHISI-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC(=C(C=C1)N)Br |