For research use only. Not for therapeutic Use.
1-(4-Aminophenyl)-2,2,2-trifluoroethanol(Cat No.:L007750), is a chemical compound with a molecular structure consisting of a trifluoromethyl group (CF3) attached to a carbon atom, connected to a phenyl ring and an amino group (NH2). The presence of both a fluoroalkyl group and an amino group makes this compound of interest in medicinal chemistry, as similar structural motifs are often found in biologically active molecules. Researchers might explore derivatives of this compound to study their biological activities, potentially leading to the development of new pharmaceutical agents or research tools in the field of medicine and drug discovery.
CAS Number | 178042-35-8 |
Molecular Formula | C8H8F3NO |
Purity | ≥95% |
IUPAC Name | 1-(4-aminophenyl)-2,2,2-trifluoroethanol |
InChI | InChI=1S/C8H8F3NO/c9-8(10,11)7(13)5-1-3-6(12)4-2-5/h1-4,7,13H,12H2 |
InChIKey | MXJOUBNXCFLFBS-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(C(F)(F)F)O)N |