Home
>
Reference Standards> 1-(4-Aminophenyl)-3-methylcarbamoyl-4-methyl-7,8-methylenedioxy-3,4-dihydro-5H-2,3-benzodiazepine
For research use only. Not for therapeutic Use.
1-(4-Aminophenyl)-3-methylcarbamoyl-4-methyl-7,8-methylenedioxy-3,4-dihydro-5H-2,3-benzodiazepine is a complex benzodiazepine derivative known for its potential pharmacological properties. This compound features multiple functional groups, including an amine and methylenedioxy moieties, which may contribute to its biological activity. Researchers investigate its applications in treating anxiety and sleep disorders, as benzodiazepines typically exhibit anxiolytic and sedative effects. The unique structural elements provide opportunities for exploring structure-activity relationships, enhancing the development of new therapeutic agents with improved efficacy and safety profiles.
Catalog Number | M137917 |
CAS Number | 143692-18-6 |
Molecular Formula | C19H20N4O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-(4-aminophenyl)-N,8-dimethyl-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxamide |
InChI | InChI=1S/C19H20N4O3/c1-11-7-13-8-16-17(26-10-25-16)9-15(13)18(22-23(11)19(24)21-2)12-3-5-14(20)6-4-12/h3-6,8-9,11H,7,10,20H2,1-2H3,(H,21,24) |
InChIKey | SMGACXZFVXKEAX-UHFFFAOYSA-N |
SMILES | CC1CC2=CC3=C(C=C2C(=NN1C(=O)NC)C4=CC=C(C=C4)N)OCO3 |