Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(4-Aminopiperidin-1-yl)-2,2-dimethylpropan-1-one hydrochloride
For research use only. Not for therapeutic Use.
1-(4-Aminopiperidin-1-yl)-2,2-dimethylpropan-1-one hydrochloride(Cat No.:L021204)is a crucial compound in pharmaceutical research and organic synthesis. Featuring an aminopiperidine ring linked to a dimethylpropanone moiety, this compound is essential for developing various bioactive molecules, including potential therapeutic agents. The hydrochloride salt form enhances its solubility and stability, making it suitable for diverse chemical transformations. Its unique structure supports targeted modifications in medicinal chemistry, aiding in the synthesis of complex compounds. High purity and consistent quality ensure reliable performance in advanced drug discovery and research applications.
CAS Number | 1286264-64-9 |
Molecular Formula | C10H21ClN2O |
Purity | ≥95% |
IUPAC Name | 1-(4-aminopiperidin-1-yl)-2,2-dimethylpropan-1-one;hydrochloride |
InChI | InChI=1S/C10H20N2O.ClH/c1-10(2,3)9(13)12-6-4-8(11)5-7-12;/h8H,4-7,11H2,1-3H3;1H |
InChIKey | HFVRCQFTPHQEQX-UHFFFAOYSA-N |
SMILES | CC(C)(C)C(=O)N1CCC(CC1)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |