For research use only. Not for therapeutic Use.
1-(4-Bromo-2-fluorophenyl)propan-1-one(CAT: L037039) is a high-purity aromatic ketone widely used in chemical and pharmaceutical research. Featuring a 4-bromo-2-fluorophenyl moiety attached to a propanone group, this compound serves as a versatile intermediate in the synthesis of complex organic molecules, including potential drug candidates and fine chemicals. Its unique structure and defined reactivity make it ideal for applications in medicinal chemistry, agrochemical development, and material science. 1-(4-Bromo-2-fluorophenyl)propan-1-one ensures consistent quality and performance, facilitating innovative research and advanced chemical synthesis.
CAS Number | 259750-61-3 |
Molecular Formula | C9H8BrFO |
Purity | ≥95% |
IUPAC Name | 1-(4-bromo-2-fluorophenyl)propan-1-one |
InChI | InChI=1S/C9H8BrFO/c1-2-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2H2,1H3 |
InChIKey | VAWRVSQLVIYZRK-UHFFFAOYSA-N |
SMILES | CCC(=O)C1=C(C=C(C=C1)Br)F |