1-(4-bromophenyl)-3-oxocyclobutanecarbonitrile(CAT: L000511) is a chemical compound with diverse applications. Its core structure combines a cyclobutanecarbonitrile ring with a 4-bromophenyl group and a carbonyl function. This compound’s versatility is evident in its usage across multiple fields. In pharmaceutical chemistry, it serves as a valuable intermediate for the synthesis of various bioactive compounds, owing to its reactivity and potential as a building block.
| Catalog Number | L000511 |
| CAS Number | 872614-37-4 |
| Molecular Formula | C11H8BrNO |
| Purity | ≥95% |
| IUPAC Name | 1-(4-bromophenyl)-3-oxocyclobutane-1-carbonitrile |
| InChI | InChI=1S/C11H8BrNO/c12-9-3-1-8(2-4-9)11(7-13)5-10(14)6-11/h1-4H,5-6H2 |
| InChIKey | IFEQWVRMPCPLSO-UHFFFAOYSA-N |
