For research use only. Not for therapeutic Use.
1-(4-Bromophenyl)prop-2-en-1-amine hydrochloride (Cat.No:L003762) is a pivotal chemical compound with diverse applications in pharmaceutical research. Its structure, featuring a bromophenyl moiety, imparts unique reactivity and biological activity. This compound serves as a valuable intermediate in the synthesis of specialized pharmaceutical agents.
CAS Number | 233608-12-3 |
Molecular Formula | C9H11BrClN |
Purity | ≥95% |
IUPAC Name | 1-(4-bromophenyl)prop-2-en-1-amine;hydrochloride |
InChI | InChI=1S/C9H10BrN.ClH/c1-2-9(11)7-3-5-8(10)6-4-7;/h2-6,9H,1,11H2;1H |
InChIKey | NUFACMNOGHWGQD-UHFFFAOYSA-N |
SMILES | C=CC(C1=CC=C(C=C1)Br)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |