For research use only. Not for therapeutic Use.
1-(4-Bromothiophen-2-yl)ethanamine hydrochloride (Cat.No:L004193) is a crucial compound in medicinal chemistry. Its distinct structure, featuring a bromothiophene and amine moiety, offers unique pharmacological potential. This compound serves as a valuable scaffold in the development of bioactive molecules, particularly in the field of pharmaceuticals.
CAS Number | 2244906-14-5 |
Molecular Formula | C6H9BrClNS |
Purity | ≥95% |
IUPAC Name | 1-(4-bromothiophen-2-yl)ethanamine;hydrochloride |
InChI | InChI=1S/C6H8BrNS.ClH/c1-4(8)6-2-5(7)3-9-6;/h2-4H,8H2,1H3;1H |
InChIKey | FDYVFPGCSXCBRM-UHFFFAOYSA-N |
SMILES | CC(C1=CC(=CS1)Br)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |