For research use only. Not for therapeutic Use.
1-[4-Chloro-2-(1’-hydroxy-1’-methylbenzyl)phenyl]-3-ethyl-2-thio-urea is a synthetic compound used in pharmaceutical research. It features a chlorinated phenyl group, a hydroxy-methylbenzyl moiety, and a thio-urea structure, which may contribute to its biological activity. This compound is investigated for its potential therapeutic applications, including anticancer and antimicrobial properties. Research focuses on its synthesis, pharmacodynamics, and mechanism of action, aiming to develop new treatments for various diseases by targeting specific biological pathways.
CAS Number | 21740-97-6 |
Synonyms | N-[4-Chloro-2-(1-hydroxy-1-phenylethyl)phenyl]-N’-ethyl-thiourea; |
Molecular Formula | C17H19ClN2OS |
Purity | 98% |
Appearance | Yellow Solid |
Storage | -20°C |
IUPAC Name | 1-[4-chloro-2-(1-hydroxy-1-phenylethyl)phenyl]-3-ethylthiourea |
InChI | InChI=1S/C17H19ClN2OS/c1-3-19-16(22)20-15-10-9-13(18)11-14(15)17(2,21)12-7-5-4-6-8-12/h4-11,21H,3H2,1-2H3,(H2,19,20,22) |
InChIKey | PSQXUHVOOSIWTL-UHFFFAOYSA-N |
SMILES | CCNC(=S)NC1=C(C=C(C=C1)Cl)C(C)(C2=CC=CC=C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |