Home
>
Reference Standards>
>
1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenyl-1,2 ,4-triazole-3-carboxamide
For research use only. Not for therapeutic Use.
1-[4-Chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenyl-1,2,4-triazole-3-carboxamide(Cat No.:M019926) is a synthetic organic molecule featuring a triazole ring, a common structure in pharmaceutical chemistry due to its versatility and biological activity. This compound incorporates various functional groups: a chlorophenyl group, a pentafluoropropoxy group, and a phenyl carboxamide, each contributing distinct chemical properties. The pentafluoropropoxy group enhances its lipophilicity and stability, making it potentially useful in drug development, particularly where increased membrane permeability is desired.
Catalog Number | M019926 |
CAS Number | 119126-15-7 |
Molecular Formula | C19H14ClF5N4O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenyl-1,2,4-triazole-3-carboxamide |
InChI | InChI=1S/C19H14ClF5N4O2/c20-14-7-6-13(8-12(14)9-31-10-18(21,22)19(23,24)25)29-17(11-4-2-1-3-5-11)27-16(28-29)15(26)30/h1-8H,9-10H2,(H2,26,30) |
InChIKey | AOQMRUTZEYVDIL-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=NC(=NN2C3=CC(=C(C=C3)Cl)COCC(C(F)(F)F)(F)F)C(=O)N |