Home
>
Chemical Reagents>Organic Building Blocks> 1-(4-Chlorophenyl)-2-methylpropan-1-amine hydrochloride
For research use only. Not for therapeutic Use.
1-(4-Chlorophenyl)-2-methylpropan-1-amine hydrochloride(Cat No.:L048858)is an important intermediate in the synthesis of pharmaceutical compounds, particularly those targeting the central nervous system. The compound features a 4-chlorophenyl group attached to a 2-methylpropan-1-amine backbone, with its hydrochloride form enhancing solubility and stability. This structure is commonly used in the development of stimulant and antidepressant medications, acting as a precursor in the synthesis of various bioactive amines. Its versatility makes it a crucial building block in medicinal chemistry and drug development.
CAS Number | 72954-91-7 |
Molecular Formula | C10H15Cl2N |
Purity | ≥95% |
IUPAC Name | 1-(4-chlorophenyl)-2-methylpropan-1-amine;hydrochloride |
InChI | InChI=1S/C10H14ClN.ClH/c1-7(2)10(12)8-3-5-9(11)6-4-8;/h3-7,10H,12H2,1-2H3;1H |
InChIKey | VCBGQWZZQKYLLK-UHFFFAOYSA-N |
SMILES | CC(C)C(C1=CC=C(C=C1)Cl)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |