For research use only. Not for therapeutic Use.
1-(4-Chlorophenyl)cyclobutane Carbonitrile is a versatile organic compound used in pharmaceutical and chemical research. Featuring a cyclobutane ring attached to a 4-chlorophenyl group and a carbonitrile functional group, this compound is valuable in the synthesis of bioactive molecules and drug discovery efforts. Its unique structure allows it to serve as a building block in the creation of more complex chemical entities, particularly in the development of compounds with potential pharmacological activity and therapeutic applications.
CAS Number | 28049-61-8 |
Synonyms | 1-(4-Chlorophenyl)cyclobutanecarbonitrile; 1-(p-Chlorophenyl)cyclobutanecarbonitrile; NSC 154613 |
Molecular Formula | C11H10ClN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(4-chlorophenyl)cyclobutane-1-carbonitrile |
InChI | InChI=1S/C11H10ClN/c12-10-4-2-9(3-5-10)11(8-13)6-1-7-11/h2-5H,1,6-7H2 |
InChIKey | XQONXPWVIZZJIL-UHFFFAOYSA-N |
SMILES | C1CC(C1)(C#N)C2=CC=C(C=C2)Cl |