For research use only. Not for therapeutic Use.
1-(4-Chloropyridin-3-yl)ethanone hydrochloride (Cat.No:L004068) is a significant chemical compound with versatile applications. Its unique structure, combining a chloropyridinyl and ethanone group, imparts distinctive reactivity. This compound serves as a valuable intermediate in the synthesis of specialized materials and pharmaceuticals.
Catalog Number | L004068 |
CAS Number | 1807467-70-4 |
Molecular Formula | C7H7Cl2NO |
Purity | ≥95% |
IUPAC Name | 1-(4-chloropyridin-3-yl)ethanone;hydrochloride |
InChI | InChI=1S/C7H6ClNO.ClH/c1-5(10)6-4-9-3-2-7(6)8;/h2-4H,1H3;1H |
InChIKey | BKBHAAOANPZGRI-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=CN=C1)Cl.Cl |