For research use only. Not for therapeutic Use.
1-(4-Chlorothiazol-5-yl)ethanone (Cat.No:L003842) is a crucial compound in pharmaceutical research. Its unique thiazole structure and ketone functionality make it a promising scaffold for drug development. This compound serves as a valuable intermediate in the synthesis of specialized pharmaceutical agents, highlighting its importance in the quest for novel therapeutic solutions.
Catalog Number | L003842 |
CAS Number | 1823347-54-1 |
Molecular Formula | C5H4ClNOS |
Purity | ≥95% |
IUPAC Name | 1-(4-chloro-1,3-thiazol-5-yl)ethanone |
InChI | InChI=1S/C5H4ClNOS/c1-3(8)4-5(6)7-2-9-4/h2H,1H3 |
InChIKey | KHLDSTRULPQZKH-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(N=CS1)Cl |