For research use only. Not for therapeutic Use.
1,4-Dibutoxy-2,3-naphthalenediimide (Cat No.:M018817), It features a naphthalene core with two butoxy groups and two imide functional groups. This compound is employed in materials science and organic electronics due to its electron-accepting properties. It serves as an essential component in the design of semiconducting materials for various electronic devices such as organic solar cells and field-effect transistors. Its distinctive structure and electron-accepting behavior contribute to its role in enabling efficient charge transport and energy conversion in these applications.
| Catalog Number | M018817 |
| CAS Number | 116453-89-5 |
| Molecular Formula | C20H22N2O2 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 1,4-dibutoxynaphthalene-2,3-dicarbonitrile |
| InChI | InChI=1S/C20H22N2O2/c1-3-5-11-23-19-15-9-7-8-10-16(15)20(24-12-6-4-2)18(14-22)17(19)13-21/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | YXJSABMTZAXNKC-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C(=C(C2=CC=CC=C21)OCCCC)C#N)C#N |
