For research use only. Not for therapeutic Use.
1-(4-Ethylphenyl)propan-1-amine hydrochloride(Cat No.:L007512), is a chemical compound featuring a propan-1-amine backbone with a 4-ethylphenyl substituent and a hydrochloride salt form. This compound is significant in organic synthesis and medicinal chemistry. Its unique structure makes it valuable for drug discovery and research. Scientists investigate its reactivity and potential biological activities, aiming to develop therapeutic agents.
Catalog Number | L007512 |
CAS Number | 1864056-95-0 |
Molecular Formula | C11H18ClN |
Purity | ≥95% |
IUPAC Name | 1-(4-ethylphenyl)propan-1-amine;hydrochloride |
InChI | InChI=1S/C11H17N.ClH/c1-3-9-5-7-10(8-6-9)11(12)4-2;/h5-8,11H,3-4,12H2,1-2H3;1H |
InChIKey | OSNYCBVXSXZCKP-UHFFFAOYSA-N |
SMILES | CCC1=CC=C(C=C1)C(CC)N.Cl |