Home
>
Chemical Reagents>Organometallic Reagents> 1-(4-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-N-methylmethanamine
For research use only. Not for therapeutic Use.
1-(4-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-N-methylmethanamine(Cat No.:L013029)is a boron-containing organic compound used in pharmaceutical and chemical research. This molecule features a fluoro-substituted phenyl ring linked to a boron-containing dioxaborolane group and a methylated amine group. It serves as a valuable intermediate in Suzuki-Miyaura cross-coupling reactions, which are essential for constructing complex molecular architectures in drug development. The compound’s unique structure facilitates the creation of diverse bioactive molecules, making it crucial in medicinal chemistry and the synthesis of advanced materials.
CAS Number | 2096334-69-7 |
Molecular Formula | C14H21BFNO2 |
Purity | ≥95% |
IUPAC Name | 1-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylmethanamine |
InChI | InChI=1S/C14H21BFNO2/c1-13(2)14(3,4)19-15(18-13)12-8-11(16)7-6-10(12)9-17-5/h6-8,17H,9H2,1-5H3 |
InChIKey | HXKMEAWDBRQUJO-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)CNC |