For research use only. Not for therapeutic Use.
1-(4-Fluoro-3-methoxyphenyl)ethanone(Cat No.:L015662), also known as p-fluoroanisyl acetone, is a chemical compound characterized by a fluoro and methoxy group attached to a benzene ring, linked to an ethanone group. This structure is notable for its potential use in organic synthesis and pharmaceutical manufacturing, particularly as an intermediate in the synthesis of more complex chemical entities. The fluoro and methoxy substituents enhance the electronic properties and increase the solubility of the molecule, making it a versatile building block for developing compounds with potential antifungal and antibacterial properties.
CAS Number | 64287-19-0 |
Molecular Formula | C9H9FO2 |
Purity | ≥95% |
IUPAC Name | 1-(4-fluoro-3-methoxyphenyl)ethanone |
InChI | InChI=1S/C9H9FO2/c1-6(11)7-3-4-8(10)9(5-7)12-2/h3-5H,1-2H3 |
InChIKey | PFEGFUCYOHBDJF-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC(=C(C=C1)F)OC |