1-(4-Fluoro-3-methoxyphenyl)thiourea(Cat No.:L019463)is a chemical compound used in pharmaceutical research and organic synthesis. It features a thiourea group attached to a 4-fluoro-3-methoxyphenyl ring, providing unique reactivity and potential biological activity. This compound is particularly valuable in the development of molecules with antithyroid, antitumor, or antimicrobial properties. The combination of fluorine and methoxy groups on the aromatic ring can influence the compound’s electronic properties, making it useful for designing new drugs and studying enzyme inhibition. It serves as a versatile building block in medicinal chemistry.
Catalog Number | L019463 |
CAS Number | 1237759-54-4 |
Molecular Formula | C8H9FN2OS |
Purity | ≥95% |
IUPAC Name | (4-fluoro-3-methoxyphenyl)thiourea |
InChI | InChI=1S/C8H9FN2OS/c1-12-7-4-5(11-8(10)13)2-3-6(7)9/h2-4H,1H3,(H3,10,11,13) |
InChIKey | PIMOEZUKRNIFNV-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)NC(=S)N)F |