Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(4-Fluorobenzyl)dihydropyrimidine-2,4(1H,3H)-dione
For research use only. Not for therapeutic Use.
1-(4-Fluorobenzyl)dihydropyrimidine-2,4(1H,3H)-dione(Cat No.:L019034)is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. This molecule features a dihydropyrimidine-dione core with a 4-fluorobenzyl group at the 1-position, making it a valuable intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity, facilitating diverse chemical transformations. 1-(4-Fluorobenzyl)dihydropyrimidine-2,4(1H,3H)-dione is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and the development of novel therapeutic agents.
CAS Number | 1263216-75-6 |
Molecular Formula | C11H11FN2O2 |
Purity | ≥95% |
IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4-dione |
InChI | InChI=1S/C11H11FN2O2/c12-9-3-1-8(2-4-9)7-14-6-5-10(15)13-11(14)16/h1-4H,5-7H2,(H,13,15,16) |
InChIKey | SCWYIPKGJFKTTO-UHFFFAOYSA-N |
SMILES | C1CN(C(=O)NC1=O)CC2=CC=C(C=C2)F |