1-(4-Fluorophenyl)but-3-en-1-amine is an organic compound used in pharmaceutical research and organic synthesis. Its structure consists of a 4-fluorophenyl group attached to a butenyl chain with an amine group at the end. This compound serves as a versatile building block for developing bioactive molecules, including drug candidates targeting neurological and receptor-related pathways. Its reactive amine group and conjugated alkene system allow for further chemical modifications, making it valuable in medicinal chemistry and drug discovery efforts.
| Catalog Number | L032969 |
| CAS Number | 1159883-05-2 |
| Molecular Formula | C10H12FN |
| Purity | ≥95% |
| IUPAC Name | 1-(4-fluorophenyl)but-3-en-1-amine |
| InChI | InChI=1S/C10H12FN/c1-2-3-10(12)8-4-6-9(11)7-5-8/h2,4-7,10H,1,3,12H2 |
| InChIKey | NLXGUZPOWJQRTI-UHFFFAOYSA-N |
