For research use only. Not for therapeutic Use.
1-(4-Hydroxybenzoyl)glucose is a chemical compound consisting of glucose (a sugar) linked to a 4-hydroxybenzoyl group. This molecule is of interest in biochemistry and natural product chemistry due to its role as an intermediate in the biosynthesis of various natural products, including plant secondary metabolites. 1-(4-Hydroxybenzoyl)glucose serves as a precursor for the formation of more complex compounds through enzymatic reactions. Understanding its biosynthetic pathways and enzymatic transformations is essential for elucidating the production of bioactive natural products in plants and microbes.
CAS Number | 25545-07-7 |
Molecular Formula | C13H16O8 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 4-hydroxybenzoate |
InChI | InChI=1S/C13H16O8/c14-5-8-9(16)10(17)11(18)13(20-8)21-12(19)6-1-3-7(15)4-2-6/h1-4,8-11,13-18H,5H2/t8-,9-,10+,11-,13+/m1/s1 |
InChIKey | XWTGDGASXRARSP-HMUNZLOLSA-N |
SMILES | C1=CC(=CC=C1C(=O)OC2C(C(C(C(O2)CO)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |