For research use only. Not for therapeutic Use.
1-(4-Hydroxyphenyl)pyridin-2(1H)-one is an organic compound featuring a hydroxyl-substituted phenyl group and a pyridinone moiety. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and antioxidant properties. Its unique structure allows for interactions with various biological targets, making it a valuable candidate for drug discovery. Research is ongoing to explore its therapeutic applications, as well as to understand its mechanisms of action and potential benefits in treating various diseases.
CAS Number | 859538-51-5 |
Synonyms | 1-(4-Hydroxyphenyl)-2(1H)-pyridinone; |
Molecular Formula | C11H9NO2 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 1-(4-hydroxyphenyl)pyridin-2-one |
InChI | InChI=1S/C11H9NO2/c13-10-6-4-9(5-7-10)12-8-2-1-3-11(12)14/h1-8,13H |
InChIKey | ORCWDXURTHUZTK-UHFFFAOYSA-N |
SMILES | C1=CC(=O)N(C=C1)C2=CC=C(C=C2)O |