For research use only. Not for therapeutic Use.
1-(4-Hydroxyphenyl)piperazine(Cat No.:L007049), is a chemical compound consisting of a piperazine ring with a phenolic group (-OH) attached at the 4-position. It is utilized in medicinal chemistry as a key intermediate and a pharmacophore in the development of various pharmaceuticals and bioactive compounds. The presence of both a piperazine moiety and a phenolic group enhances its biological activities, making it valuable in the synthesis of drugs targeting the central nervous system and other therapeutic areas. Its significance lies in its role as a building block in the creation of diverse molecules for medicinal and biological research purposes.
CAS Number | 56621-48-8 |
Molecular Formula | C10H14N2O |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | 4-piperazin-1-ylphenol |
InChI | InChI=1S/C10H14N2O/c13-10-3-1-9(2-4-10)12-7-5-11-6-8-12/h1-4,11,13H,5-8H2 |
InChIKey | GPEOAEVZTOQXLG-UHFFFAOYSA-N |
SMILES | C1CN(CCN1)C2=CC=C(C=C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |