Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(4-Methoxybenzyl)-1H-pyrazole-4-carboxylic acid
For research use only. Not for therapeutic Use.
1-(4-Methoxybenzyl)-1H-pyrazole-4-carboxylic acid(Cat No.:L026710)is a heterocyclic compound that combines a methoxybenzyl group with a pyrazole carboxylic acid moiety. This compound is widely used in pharmaceutical research as an intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its structure allows for versatile functionalization, making it valuable in the development of inhibitors, anti-inflammatory agents, and other therapeutic compounds. With its high purity and consistent quality, 1-(4-Methoxybenzyl)-1H-pyrazole-4-carboxylic acid supports advanced research in medicinal chemistry and organic synthesis.
CAS Number | 1105039-93-7 |
Molecular Formula | C12H12N2O3 |
Purity | ≥95% |
IUPAC Name | 1-[(4-methoxyphenyl)methyl]pyrazole-4-carboxylic acid |
InChI | InChI=1S/C12H12N2O3/c1-17-11-4-2-9(3-5-11)7-14-8-10(6-13-14)12(15)16/h2-6,8H,7H2,1H3,(H,15,16) |
InChIKey | JMWJJDKQQMMJRG-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)CN2C=C(C=N2)C(=O)O |