For research use only. Not for therapeutic Use.
1-(4-Methoxybenzyl)isoquinoline(CAT: L000454) is a compound that finds relevance in organic chemistry and potentially in pharmaceutical applications. In organic chemistry, it serves as a building block for the synthesis of various organic molecules, enabling the creation of diverse chemical structures. This compound may also have potential applications in pharmaceuticals, as isoquinoline derivatives are often investigated for their biological activity and can serve as structural motifs in drug development.
Catalog Number | L000454 |
CAS Number | 10172-49-3 |
Molecular Formula | C17H15NO |
Purity | ≥95% |
IUPAC Name | 1-[(4-methoxyphenyl)methyl]isoquinoline |
InChI | InChI=1S/C17H15NO/c1-19-15-8-6-13(7-9-15)12-17-16-5-3-2-4-14(16)10-11-18-17/h2-11H,12H2,1H3 |
InChIKey | BYWUJWHEAQYATL-UHFFFAOYSA-N |