1-(4-Methoxyphenyl)cyclobutanecarboxylic acid

For research use only. Not for therapeutic Use.

  • CAT Number: L040072
  • CAS Number: 50921-37-4
  • Molecular Formula: C12H14O3
  • Molecular Weight: 206.24
  • Purity: ≥95%
Inquiry Now

1-(4-Methoxyphenyl)cyclobutanecarboxylic acid(Cat No.:L040072)is a specialized organic compound used in pharmaceutical and chemical research. Featuring a methoxy-substituted phenyl ring attached to a cyclobutanecarboxylic acid core, this compound serves as a crucial intermediate in the synthesis of complex molecules. Its unique structure allows for diverse chemical modifications, making it valuable in the development of new therapeutic agents and agrochemicals. 1-(4-Methoxyphenyl)cyclobutanecarboxylic acid is essential for high-precision synthesis and innovative research, contributing to advancements in medicinal chemistry and drug development.


CAS Number 50921-37-4
Molecular Formula C12H14O3
Purity ≥95%
IUPAC Name 1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid
InChI InChI=1S/C12H14O3/c1-15-10-5-3-9(4-6-10)12(11(13)14)7-2-8-12/h3-6H,2,7-8H2,1H3,(H,13,14)
InChIKey FKPWMQWXYOZELT-UHFFFAOYSA-N
SMILES COC1=CC=C(C=C1)C2(CCC2)C(=O)O

Request a Quote