For research use only. Not for therapeutic Use.
1-(4-Methoxypyridin-2-yl)ethan-1-amine(Cat No.:L007817), is a chemical compound with the molecular formula C8H12N2O. This compound consists of a pyridine ring substituted with a methoxy group (-OCH3) and an ethylamine group (-NHCH2CH3) at specific positions. Pyridine derivatives find applications in various fields, including pharmaceuticals, agrochemicals, and materials science. Compounds with similar structures often exhibit biological activities, making them important in drug discovery processes.
Catalog Number | L007817 |
CAS Number | 58088-65-6 |
Molecular Formula | C8H12N2O |
Purity | ≥95% |
IUPAC Name | 1-(4-methoxypyridin-2-yl)ethanamine |
InChI | InChI=1S/C8H12N2O/c1-6(9)8-5-7(11-2)3-4-10-8/h3-6H,9H2,1-2H3 |
InChIKey | BSYZGYVTKXXLSZ-UHFFFAOYSA-N |
SMILES | CC(C1=NC=CC(=C1)OC)N |