For research use only. Not for therapeutic Use.
1-(4-Nitrobenzyl)piperidine is an organic compound featuring a piperidine ring bonded to a 4-nitrobenzyl group at the nitrogen atom. The nitrobenzyl moiety introduces electron-withdrawing properties, enhancing the compound’s reactivity in chemical synthesis. Frequently used as an intermediate in pharmaceutical research, it serves as a precursor for more complex molecules, particularly those targeting neurological pathways. Its structure makes it valuable for the synthesis of bioactive compounds, including potential therapeutics in medicinal chemistry and drug development.
CAS Number | 59507-44-7 |
Molecular Formula | C12H16N2O2 |
Purity | ≥95% |
IUPAC Name | 1-[(4-nitrophenyl)methyl]piperidine |
InChI | InChI=1S/C12H16N2O2/c15-14(16)12-6-4-11(5-7-12)10-13-8-2-1-3-9-13/h4-7H,1-3,8-10H2 |
InChIKey | PAMJENUKCYUKLC-UHFFFAOYSA-N |
SMILES | C1CCN(CC1)CC2=CC=C(C=C2)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |