For research use only. Not for therapeutic Use.
1-(4-Nitrophenyl)-1H-pyrrole(CAT: L020954) is an aromatic compound where a pyrrole ring is substituted at the nitrogen atom by a 4-nitrophenyl group. This structure combines the electron-donating properties of the pyrrole with the electron-withdrawing nature of the nitro group on the phenyl ring, making it useful in various chemical and biological studies. The compound can serve as a precursor or building block in the synthesis of heterocyclic compounds and bioactive molecules, particularly in the fields of medicinal chemistry and materials science. 1-(4-Nitrophenyl)-1H-pyrrole is also relevant in the study of charge transfer and conjugated systems, supporting applications in drug discovery and organic electronics.
CAS Number | 4533-42-0 |
Molecular Formula | C10H8N2O2 |
Purity | ≥95% |
IUPAC Name | 1-(4-nitrophenyl)pyrrole |
InChI | InChI=1S/C10H8N2O2/c13-12(14)10-5-3-9(4-6-10)11-7-1-2-8-11/h1-8H |
InChIKey | PWCFKNYSCGRNRW-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |