For research use only. Not for therapeutic Use.
1-(4-Nitrophenyl)piperidine (Cat.No:L038934) is a chemical intermediate used in the synthesis of various organic compounds. Its piperidine ring and nitrophenyl group offer versatility for creating complex molecules with diverse applications. This compound serves as a valuable tool in pharmaceutical, agrochemical, and material science research.
CAS Number | 6574-15-8 |
Molecular Formula | C11H14N2O2 |
Purity | ≥95% |
IUPAC Name | 1-(4-nitrophenyl)piperidine |
InChI | InChI=1S/C11H14N2O2/c14-13(15)11-6-4-10(5-7-11)12-8-2-1-3-9-12/h4-7H,1-3,8-9H2 |
InChIKey | SGPLAXFUDTWHRS-UHFFFAOYSA-N |