1-[4-(Pyridin-3-yl)phenyl]ethan-1-amine

For research use only. Not for therapeutic Use.

  • CAT Number: L007600
  • CAS Number: 885468-60-0
  • Molecular Formula: C13H14N2
  • Molecular Weight: 198.26
  • Purity: ≥95%
Inquiry Now

1-[4-(Pyridin-3-yl)phenyl]ethan-1-amine(Cat No.:L007600), is a chemical compound featuring an ethylamine group attached to a phenyl ring substituted with a pyridin-3-yl group at the 4-position. This specific molecular arrangement is significant in medicinal chemistry and drug discovery. Researchers explore its potential biological activities, aiming to understand its role in various physiological processes. Its unique structure allows for diverse chemical modifications, making it valuable in the synthesis of novel compounds for biological testing.


Catalog Number L007600
CAS Number 885468-60-0
Molecular Formula C13H14N2
Purity ≥95%
IUPAC Name 1-(4-pyridin-3-ylphenyl)ethanamine
InChI InChI=1S/C13H14N2/c1-10(14)11-4-6-12(7-5-11)13-3-2-8-15-9-13/h2-10H,14H2,1H3
InChIKey OGGKRFGMVHUZQV-UHFFFAOYSA-N
SMILES CC(C1=CC=C(C=C1)C2=CN=CC=C2)N

Request a Quote