For research use only. Not for therapeutic Use.
1-[4-(Pyridin-3-yl)phenyl]ethan-1-amine(Cat No.:L007600), is a chemical compound featuring an ethylamine group attached to a phenyl ring substituted with a pyridin-3-yl group at the 4-position. This specific molecular arrangement is significant in medicinal chemistry and drug discovery. Researchers explore its potential biological activities, aiming to understand its role in various physiological processes. Its unique structure allows for diverse chemical modifications, making it valuable in the synthesis of novel compounds for biological testing.
CAS Number | 885468-60-0 |
Molecular Formula | C13H14N2 |
Purity | ≥95% |
IUPAC Name | 1-(4-pyridin-3-ylphenyl)ethanamine |
InChI | InChI=1S/C13H14N2/c1-10(14)11-4-6-12(7-5-11)13-3-2-8-15-9-13/h2-10H,14H2,1H3 |
InChIKey | OGGKRFGMVHUZQV-UHFFFAOYSA-N |
SMILES | CC(C1=CC=C(C=C1)C2=CN=CC=C2)N |